C23H21ClFN3O — CID 123513607
N-(3-chloro-4-fluorophenyl)-5-methoxy-2-methyl-N'-[1-(6-methyl-3-pyridinyl)ethenyl]benzenecarboximidamide (PubChem CID 123513607) has the molecular formula C23H21ClFN3O and a molecular weight of 409.89 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-methoxy-2-methyl-N'-[1-(6-methyl-3-pyridinyl)ethenyl]benzenecarboximidamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-methoxy-2-methyl-N'-[1-(6-methyl-3-pyridinyl)ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123513607 |
| Molecular Formula | C23H21ClFN3O |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-methoxy-2-methyl-N'-[1-(6-methyl-3-pyridinyl)ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(/Nc1ccc(F)c(Cl)c1)c1cc(OC)ccc1C)c1ccc(C)nc1 |
| InChI | InChI=1S/C23H21ClFN3O/c1-14-5-9-19(29-4)12-20(14)23(28-18-8-10-22(25)21(24)11-18)27-16(3)17-7-6-15(2)26-13-17/h5-13H,3H2,1-2,4H3,(H,27,28) |
| InChIKey | MAARMVDQNMTFDW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|