C23H22ClN3O — CID 89347951
5-chloro-N-(3-methoxy-4-methylphenyl)-2-methyl-N'-(1-pyridin-3-ylethenyl)benzenecarboximidamide (PubChem CID 89347951) has the molecular formula C23H22ClN3O and a molecular weight of 391.90 g/mol. Its IUPAC name is 5-chloro-N-(3-methoxy-4-methylphenyl)-2-methyl-N'-(1-pyridin-3-ylethenyl)benzenecarboximidamide.
| Compound Name | 5-chloro-N-(3-methoxy-4-methylphenyl)-2-methyl-N'-(1-pyridin-3-ylethenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 89347951 |
| Molecular Formula | C23H22ClN3O |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-chloro-N-(3-methoxy-4-methylphenyl)-2-methyl-N'-(1-pyridin-3-ylethenyl)benzenecarboximidamide |
| SMILES | C=C(/N=C(/Nc1ccc(C)c(OC)c1)c1cc(Cl)ccc1C)c1cccnc1 |
| InChI | InChI=1S/C23H22ClN3O/c1-15-7-9-19(24)12-21(15)23(26-17(3)18-6-5-11-25-14-18)27-20-10-8-16(2)22(13-20)28-4/h5-14H,3H2,1-2,4H3,(H,26,27) |
| InChIKey | RLDXQDVMPQVDHB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|