C21H16Cl2FN3 — CID 89348126
5-chloro-N'-(4-chloro-2-fluorophenyl)-2-methyl-N-(1-pyridin-3-ylethenyl)benzenecarboximidamide (PubChem CID 89348126) has the molecular formula C21H16Cl2FN3 and a molecular weight of 400.28 g/mol. Its IUPAC name is 5-chloro-N'-(4-chloro-2-fluorophenyl)-2-methyl-N-(1-pyridin-3-ylethenyl)benzenecarboximidamide.
| Compound Name | 5-chloro-N'-(4-chloro-2-fluorophenyl)-2-methyl-N-(1-pyridin-3-ylethenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 89348126 |
| Molecular Formula | C21H16Cl2FN3 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5-chloro-N'-(4-chloro-2-fluorophenyl)-2-methyl-N-(1-pyridin-3-ylethenyl)benzenecarboximidamide |
| SMILES | C=C(N/C(=N\c1ccc(Cl)cc1F)c1cc(Cl)ccc1C)c1cccnc1 |
| InChI | InChI=1S/C21H16Cl2FN3/c1-13-5-6-16(22)10-18(13)21(26-14(2)15-4-3-9-25-12-15)27-20-8-7-17(23)11-19(20)24/h3-12H,2H2,1H3,(H,26,27) |
| InChIKey | HNGLYUZETSHFHC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|