C15H9ClF2N2 — CID 82814758
(Z)-3-chloro-3-(2,6-difluoro-3-methylphenyl)-2-pyridin-3-ylprop-2-enenitrile (PubChem CID 82814758) has the molecular formula C15H9ClF2N2 and a molecular weight of 290.70 g/mol. Its IUPAC name is (Z)-3-chloro-3-(2,6-difluoro-3-methylphenyl)-2-pyridin-3-ylprop-2-enenitrile.
| Compound Name | (Z)-3-chloro-3-(2,6-difluoro-3-methylphenyl)-2-pyridin-3-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 82814758 |
| Molecular Formula | C15H9ClF2N2 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (Z)-3-chloro-3-(2,6-difluoro-3-methylphenyl)-2-pyridin-3-ylprop-2-enenitrile |
| SMILES | Cc1ccc(F)c(/C(Cl)=C(/C#N)c2cccnc2)c1F |
| InChI | InChI=1S/C15H9ClF2N2/c1-9-4-5-12(17)13(15(9)18)14(16)11(7-19)10-3-2-6-20-8-10/h2-6,8H,1H3/b14-11+ |
| InChIKey | VGJUZQARSQOAMY-SDNWHVSQSA-N |
| XLogP | 4.30 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|