C12H5Br2ClN2S — CID 114021414
(E)-3-chloro-3-(2,5-dibromothiophen-3-yl)-2-pyridin-3-ylprop-2-enenitrile (PubChem CID 114021414) has the molecular formula C12H5Br2ClN2S and a molecular weight of 404.51 g/mol. Its IUPAC name is (E)-3-chloro-3-(2,5-dibromothiophen-3-yl)-2-pyridin-3-ylprop-2-enenitrile.
| Compound Name | (E)-3-chloro-3-(2,5-dibromothiophen-3-yl)-2-pyridin-3-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 114021414 |
| Molecular Formula | C12H5Br2ClN2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 401.82 |
| IUPAC Name | (E)-3-chloro-3-(2,5-dibromothiophen-3-yl)-2-pyridin-3-ylprop-2-enenitrile |
| SMILES | N#C/C(=C(/Cl)c1cc(Br)sc1Br)c1cccnc1 |
| InChI | InChI=1S/C12H5Br2ClN2S/c13-10-4-8(12(14)18-10)11(15)9(5-16)7-2-1-3-17-6-7/h1-4,6H/b11-9- |
| InChIKey | LIZWEDPLUFKSIX-LUAWRHEFSA-N |
| XLogP | 5.30 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|