About (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile
(Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile (PubChem CID 114033609) has the molecular formula C13H12N4S
and a molecular weight of 256.33 g/mol. Its IUPAC name is (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile |
| PubChem CID | 114033609 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile |
| SMILES | Cc1nc(C)c(/C(N)=C(/C#N)c2cccnc2)s1 |
| InChI | InChI=1S/C13H12N4S/c1-8-13(18-9(2)17-8)12(15)11(6-14)10-4-3-5-16-7-10/h3-5,7H,15H2,1-2H3/b12-11+ |
| InChIKey | IPUSQZMKVPCVSV-VAWYXSNFSA-N |
| XLogP | 2.51 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile?
The IUPAC name of (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile (CID 114033609) is (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile.
What is the SMILES notation for (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile?
The canonical SMILES for (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile is Cc1nc(C)c(/C(N)=C(/C#N)c2cccnc2)s1.
What is the InChIKey of (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile?
The InChIKey is IPUSQZMKVPCVSV-VAWYXSNFSA-N. The full InChI is InChI=1S/C13H12N4S/c1-8-13(18-9(2)17-8)12(15)11(6-14)10-4-3-5-16-7-10/h3-5,7H,15H2,1-2H3/b12-11+.
What are the key properties of (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile?
(Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile has a molecular weight of 256.33 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-pyridin-3-ylprop-2-enenitrile is sourced from PubChem (CID 114033609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).