C19H20ClF3N4O — CID 142147279
N'-[(Z)-1-(5-chloro-2-methoxyanilino)-4,4-difluorobut-1-enyl]-N-methylidenepyridine-3-carboximidamide;fluoromethane (PubChem CID 142147279) has the molecular formula C19H20ClF3N4O and a molecular weight of 412.84 g/mol. Its IUPAC name is N'-[(Z)-1-(5-chloro-2-methoxyanilino)-4,4-difluorobut-1-enyl]-N-methylidenepyridine-3-carboximidamide;fluoromethane.
| Compound Name | N'-[(Z)-1-(5-chloro-2-methoxyanilino)-4,4-difluorobut-1-enyl]-N-methylidenepyridine-3-carboximidamide;fluoromethane |
|---|---|
| PubChem CID | 142147279 |
| Molecular Formula | C19H20ClF3N4O |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N'-[(Z)-1-(5-chloro-2-methoxyanilino)-4,4-difluorobut-1-enyl]-N-methylidenepyridine-3-carboximidamide;fluoromethane |
| SMILES | C=N/C(=N\C(=C/CC(F)F)Nc1cc(Cl)ccc1OC)c1cccnc1.CF |
| InChI | InChI=1S/C18H17ClF2N4O.CH3F/c1-22-18(12-4-3-9-23-11-12)25-17(8-7-16(20)21)24-14-10-13(19)5-6-15(14)26-2;1-2/h3-6,8-11,16,24H,1,7H2,2H3;1H3/b17-8-,25-18-; |
| InChIKey | SEDYGKSWVGRBTR-PPEBZTKQSA-N |
| XLogP | 5.39 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|