C22H21ClFN3O2S — CID 145016658
N-(3-chloro-4-fluorophenyl)-N'-ethenyl-5-methoxy-2-methyl-4-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzenecarboximidamide (PubChem CID 145016658) has the molecular formula C22H21ClFN3O2S and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-ethenyl-5-methoxy-2-methyl-4-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzenecarboximidamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-ethenyl-5-methoxy-2-methyl-4-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 145016658 |
| Molecular Formula | C22H21ClFN3O2S |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-ethenyl-5-methoxy-2-methyl-4-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzenecarboximidamide |
| SMILES | C=C/N=C(/Nc1ccc(F)c(Cl)c1)c1cc(OC)c(OCc2cnc(C)s2)cc1C |
| InChI | InChI=1S/C22H21ClFN3O2S/c1-5-25-22(27-15-6-7-19(24)18(23)9-15)17-10-20(28-4)21(8-13(17)2)29-12-16-11-26-14(3)30-16/h5-11H,1,12H2,2-4H3,(H,25,27) |
| InChIKey | RULABDDKRARMFG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|