C18H18ClFN2O5 — CID 9104065
methyl 2-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate (PubChem CID 9104065) has the molecular formula C18H18ClFN2O5 and a molecular weight of 396.80 g/mol. Its IUPAC name is methyl 2-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 9104065 |
| Molecular Formula | C18H18ClFN2O5 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | methyl 2-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2O5/c1-25-15-7-11(18(24)27-3)14(8-16(15)26-2)21-9-17(23)22-10-4-5-13(20)12(19)6-10/h4-8,21H,9H2,1-3H3,(H,22,23) |
| InChIKey | OUJSGAKOEFPLSD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|