methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate

C11H15NO2 — CID 123513977

IUPACmethyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate
SMILESC=NC=CC=C(C)C(C)=CC(=O)OC
InChIInChI=1S/C11H15NO2/c1-9(6-5-7-12-3)10(2)8-11(13)14-4/h5-8H,3H2,1-2,4H3
InChIKeyMROJLHDEHJLAKK-UHFFFAOYSA-N
MW193.25 g/mol
LogP2.27
Rot. Bonds4

About methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate

methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate (PubChem CID 123513977) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate.

Molecular Properties

Compound Namemethyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate
PubChem CID123513977
Molecular FormulaC11H15NO2
Molecular Weight193.25 g/mol
Exact Mass193.11
IUPAC Namemethyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate
SMILESC=NC=CC=C(C)C(C)=CC(=O)OC
InChIInChI=1S/C11H15NO2/c1-9(6-5-7-12-3)10(2)8-11(13)14-4/h5-8H,3H2,1-2,4H3
InChIKeyMROJLHDEHJLAKK-UHFFFAOYSA-N
XLogP2.27
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.25
LogP ≤ 52.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate?
The IUPAC name of methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate (CID 123513977) is methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate.
What is the SMILES notation for methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate?
The canonical SMILES for methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate is C=NC=CC=C(C)C(C)=CC(=O)OC.
What is the InChIKey of methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate?
The InChIKey is MROJLHDEHJLAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-9(6-5-7-12-3)10(2)8-11(13)14-4/h5-8H,3H2,1-2,4H3.
What are the key properties of methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate?
methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate has a molecular weight of 193.25 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate is sourced from PubChem (CID 123513977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).