C11H15NO2 — CID 123513977
methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate (PubChem CID 123513977) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate.
| Compound Name | methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 123513977 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl 3,4-dimethyl-7-(methylideneamino)hepta-2,4,6-trienoate |
| SMILES | C=NC=CC=C(C)C(C)=CC(=O)OC |
| InChI | InChI=1S/C11H15NO2/c1-9(6-5-7-12-3)10(2)8-11(13)14-4/h5-8H,3H2,1-2,4H3 |
| InChIKey | MROJLHDEHJLAKK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|