C23H24N2O3 — CID 123514073
(E)-1-[3-[(4-hydroxypiperazin-1-yl)methyl]phenyl]-3-[3-(3-oxoprop-2-enyl)phenyl]prop-2-en-1-one (PubChem CID 123514073) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-1-[3-[(4-hydroxypiperazin-1-yl)methyl]phenyl]-3-[3-(3-oxoprop-2-enyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(4-hydroxypiperazin-1-yl)methyl]phenyl]-3-[3-(3-oxoprop-2-enyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123514073 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (E)-1-[3-[(4-hydroxypiperazin-1-yl)methyl]phenyl]-3-[3-(3-oxoprop-2-enyl)phenyl]prop-2-en-1-one |
| SMILES | O=C=CCc1cccc(/C=C/C(=O)c2cccc(CN3CCN(O)CC3)c2)c1 |
| InChI | InChI=1S/C23H24N2O3/c26-15-3-7-19-4-1-5-20(16-19)9-10-23(27)22-8-2-6-21(17-22)18-24-11-13-25(28)14-12-24/h1-6,8-10,16-17,28H,7,11-14,18H2/b10-9+ |
| InChIKey | QBPFRJOADDWDBD-MDZDMXLPSA-N |
| XLogP | 3.02 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|