C18H35BO2 — CID 123515182
2-(6,6-dimethylcyclodecyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123515182) has the molecular formula C18H35BO2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-(6,6-dimethylcyclodecyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(6,6-dimethylcyclodecyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123515182 |
| Molecular Formula | C18H35BO2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 2-(6,6-dimethylcyclodecyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)CCCCC(B2OC(C)(C)C(C)(C)O2)CCCC1 |
| InChI | InChI=1S/C18H35BO2/c1-16(2)13-9-7-11-15(12-8-10-14-16)19-20-17(3,4)18(5,6)21-19/h15H,7-14H2,1-6H3 |
| InChIKey | AHOPGOLJRKSYLM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|