C19H37BO2 — CID 123946794
4,4,5,5-tetramethyl-2-(1,5,5-trimethylcyclodecyl)-1,3,2-dioxaborolane (PubChem CID 123946794) has the molecular formula C19H37BO2 and a molecular weight of 308.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1,5,5-trimethylcyclodecyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1,5,5-trimethylcyclodecyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123946794 |
| Molecular Formula | C19H37BO2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1,5,5-trimethylcyclodecyl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)CCCCCC(C)(B2OC(C)(C)C(C)(C)O2)CCC1 |
| InChI | InChI=1S/C19H37BO2/c1-16(2)12-9-8-10-14-19(7,15-11-13-16)20-21-17(3,4)18(5,6)22-20/h8-15H2,1-7H3 |
| InChIKey | WGPKPBKEBNMQHB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|