C39H75BO2 — CID 91517613
2-[4-[2-[1,5-di(propan-2-yl)cyclononyl]propyl]-1,4,7-trimethyl-7-propylcyclononyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 91517613) has the molecular formula C39H75BO2 and a molecular weight of 586.84 g/mol. Its IUPAC name is 2-[4-[2-[1,5-di(propan-2-yl)cyclononyl]propyl]-1,4,7-trimethyl-7-propylcyclononyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[2-[1,5-di(propan-2-yl)cyclononyl]propyl]-1,4,7-trimethyl-7-propylcyclononyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 91517613 |
| Molecular Formula | C39H75BO2 |
| Molecular Weight | 586.84 g/mol |
| Exact Mass | 586.59 |
| IUPAC Name | 2-[4-[2-[1,5-di(propan-2-yl)cyclononyl]propyl]-1,4,7-trimethyl-7-propylcyclononyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC1(C)CCC(C)(CC(C)C2(C(C)C)CCCCC(C(C)C)CCC2)CCC(C)(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C39H75BO2/c1-14-20-36(11)23-24-37(12,26-28-38(13,27-25-36)40-41-34(7,8)35(9,10)42-40)29-32(6)39(31(4)5)21-16-15-18-33(30(2)3)19-17-22-39/h30-33H,14-29H2,1-13H3 |
| InChIKey | KGRIGHUZMHTVMY-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.84 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|