C17H33BO2 — CID 123335941
2-(1,5-dimethylcyclononyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123335941) has the molecular formula C17H33BO2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-(1,5-dimethylcyclononyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,5-dimethylcyclononyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123335941 |
| Molecular Formula | C17H33BO2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 2-(1,5-dimethylcyclononyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CCCCC(C)(B2OC(C)(C)C(C)(C)O2)CCC1 |
| InChI | InChI=1S/C17H33BO2/c1-14-10-7-8-12-17(6,13-9-11-14)18-19-15(2,3)16(4,5)20-18/h14H,7-13H2,1-6H3 |
| InChIKey | IZTNEUSZILOGNV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|