C16H31BO2 — CID 134966185
4,4,5,5-tetramethyl-2-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1,3,2-dioxaborolane (PubChem CID 134966185) has the molecular formula C16H31BO2 and a molecular weight of 266.23 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134966185 |
| Molecular Formula | C16H31BO2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H31BO2/c1-11(2)13-9-8-12(3)10-14(13)17-18-15(4,5)16(6,7)19-17/h11-14H,8-10H2,1-7H3/t12-,13+,14?/m1/s1 |
| InChIKey | GXENTCUOLKUXOV-AMIUJLCOSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|