C17H18N4O3 — CID 123515365
2-cyanoethyl 2-[4-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]acetate (PubChem CID 123515365) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-cyanoethyl 2-[4-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]acetate.
| Compound Name | 2-cyanoethyl 2-[4-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]acetate |
|---|---|
| PubChem CID | 123515365 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-cyanoethyl 2-[4-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]acetate |
| SMILES | N#CCCOC(=O)Cc1ccc2c(c1)N(Cc1cnc[nH]1)CCO2 |
| InChI | InChI=1S/C17H18N4O3/c18-4-1-6-24-17(22)9-13-2-3-16-15(8-13)21(5-7-23-16)11-14-10-19-12-20-14/h2-3,8,10,12H,1,5-7,9,11H2,(H,19,20) |
| InChIKey | PPLYNIHGBFVTHO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|