About methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate
methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate (PubChem CID 123516232) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate.
Molecular Properties
| Compound Name | methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate |
| PubChem CID | 123516232 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate |
| SMILES | COC(=O)C(C)(C)C=Cc1ccc2cnc(C(C)O)cc2c1 |
| InChI | InChI=1S/C18H21NO3/c1-12(20)16-10-15-9-13(5-6-14(15)11-19-16)7-8-18(2,3)17(21)22-4/h5-12,20H,1-4H3 |
| InChIKey | RBEDQCQTBUCDIC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate?
The IUPAC name of methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate (CID 123516232) is methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate.
What is the SMILES notation for methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate?
The canonical SMILES for methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate is COC(=O)C(C)(C)C=Cc1ccc2cnc(C(C)O)cc2c1.
What is the InChIKey of methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate?
The InChIKey is RBEDQCQTBUCDIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3/c1-12(20)16-10-15-9-13(5-6-14(15)11-19-16)7-8-18(2,3)17(21)22-4/h5-12,20H,1-4H3.
What are the key properties of methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate?
methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate has a molecular weight of 299.37 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-(1-hydroxyethyl)isoquinolin-6-yl]-2,2-dimethylbut-3-enoate is sourced from PubChem (CID 123516232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).