C26H35NO5 — CID 126630142
methyl (E)-4-[2-[(1R)-1-hydroxyethyl]quinolin-7-yl]-2-methyl-2-[2-[3-(oxolan-2-yl)propoxy]ethyl]but-3-enoate (PubChem CID 126630142) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl (E)-4-[2-[(1R)-1-hydroxyethyl]quinolin-7-yl]-2-methyl-2-[2-[3-(oxolan-2-yl)propoxy]ethyl]but-3-enoate.
| Compound Name | methyl (E)-4-[2-[(1R)-1-hydroxyethyl]quinolin-7-yl]-2-methyl-2-[2-[3-(oxolan-2-yl)propoxy]ethyl]but-3-enoate |
|---|---|
| PubChem CID | 126630142 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | methyl (E)-4-[2-[(1R)-1-hydroxyethyl]quinolin-7-yl]-2-methyl-2-[2-[3-(oxolan-2-yl)propoxy]ethyl]but-3-enoate |
| SMILES | COC(=O)C(C)(/C=C/c1ccc2ccc([C@@H](C)O)nc2c1)CCOCCCC1CCCO1 |
| InChI | InChI=1S/C26H35NO5/c1-19(28)23-11-10-21-9-8-20(18-24(21)27-23)12-13-26(2,25(29)30-3)14-17-31-15-4-6-22-7-5-16-32-22/h8-13,18-19,22,28H,4-7,14-17H2,1-3H3/b13-12+/t19-,22?,26?/m1/s1 |
| InChIKey | COONNLLKQLYVTL-ZZPGIOIXSA-N |
| XLogP | 4.85 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|