C25H42ClN3 — CID 123517462
(2R)-N-(3a,4,5,6,7,7a-hexahydro-3H-indol-2-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine (PubChem CID 123517462) has the molecular formula C25H42ClN3 and a molecular weight of 420.09 g/mol. Its IUPAC name is (2R)-N-(3a,4,5,6,7,7a-hexahydro-3H-indol-2-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine.
| Compound Name | (2R)-N-(3a,4,5,6,7,7a-hexahydro-3H-indol-2-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 123517462 |
| Molecular Formula | C25H42ClN3 |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | (2R)-N-(3a,4,5,6,7,7a-hexahydro-3H-indol-2-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)CC1)NCC1=NC2CCCCC2C1 |
| InChI | InChI=1S/C25H42ClN3/c1-18(2)25(27-16-23-15-21-5-3-4-6-24(21)28-23)17-29-13-11-20(12-14-29)19-7-9-22(26)10-8-19/h7,9,18-22,24-25,27H,3-6,8,10-17H2,1-2H3/t19?,21?,22?,24?,25-/m0/s1 |
| InChIKey | GGXPOEDDLLKNDY-YIRIBBDYSA-N |
| XLogP | 5.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|