C25H42ClN3O — CID 58457608
2-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3a,4,5,6,7,7a-hexahydro-1H-indol-5-ol (PubChem CID 58457608) has the molecular formula C25H42ClN3O and a molecular weight of 436.08 g/mol. Its IUPAC name is 2-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3a,4,5,6,7,7a-hexahydro-1H-indol-5-ol.
| Compound Name | 2-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3a,4,5,6,7,7a-hexahydro-1H-indol-5-ol |
|---|---|
| PubChem CID | 58457608 |
| Molecular Formula | C25H42ClN3O |
| Molecular Weight | 436.08 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 2-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3a,4,5,6,7,7a-hexahydro-1H-indol-5-ol |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)CC1)NCC1=CC2CC(O)CCC2N1 |
| InChI | InChI=1S/C25H42ClN3O/c1-17(2)25(27-15-22-13-20-14-23(30)7-8-24(20)28-22)16-29-11-9-19(10-12-29)18-3-5-21(26)6-4-18/h3,5,13,17-21,23-25,27-28,30H,4,6-12,14-16H2,1-2H3/t18?,20?,21?,23?,24?,25-/m0/s1 |
| InChIKey | APKCPJAWVMRKCO-FDWPZZBRSA-N |
| XLogP | 3.90 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.08 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|