C26H46ClN3O2 — CID 159907249
(2R)-N-(1,2,3,4,4a,8a-hexahydroquinolin-3-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine;dihydrate (PubChem CID 159907249) has the molecular formula C26H46ClN3O2 and a molecular weight of 468.13 g/mol. Its IUPAC name is (2R)-N-(1,2,3,4,4a,8a-hexahydroquinolin-3-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine;dihydrate.
| Compound Name | (2R)-N-(1,2,3,4,4a,8a-hexahydroquinolin-3-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine;dihydrate |
|---|---|
| PubChem CID | 159907249 |
| Molecular Formula | C26H46ClN3O2 |
| Molecular Weight | 468.13 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | (2R)-N-(1,2,3,4,4a,8a-hexahydroquinolin-3-ylmethyl)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methylbutan-2-amine;dihydrate |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)CC1)NCC1CNC2C=CC=CC2C1.O.O |
| InChI | InChI=1S/C26H42ClN3.2H2O/c1-19(2)26(29-17-20-15-23-5-3-4-6-25(23)28-16-20)18-30-13-11-22(12-14-30)21-7-9-24(27)10-8-21;;/h3-7,9,19-26,28-29H,8,10-18H2,1-2H3;2*1H2/t20?,21?,23?,24?,25?,26-;;/m0../s1 |
| InChIKey | OMCGRUQRUMLRCE-ROUBQLRISA-N |
| XLogP | 2.96 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|