About 1-N-methylsulfanylpropane-1,2-diimine
1-N-methylsulfanylpropane-1,2-diimine (PubChem CID 123518003) has the molecular formula C4H8N2S
and a molecular weight of 116.19 g/mol. Its IUPAC name is 1-N-methylsulfanylpropane-1,2-diimine.
Molecular Properties
| Compound Name | 1-N-methylsulfanylpropane-1,2-diimine |
| PubChem CID | 123518003 |
| Molecular Formula | C4H8N2S |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 1-N-methylsulfanylpropane-1,2-diimine |
| SMILES | [H]/N=C(\C)C=NSC |
| InChI | InChI=1S/C4H8N2S/c1-4(5)3-6-7-2/h3,5H,1-2H3/b5-4+,6-3? |
| InChIKey | KRLRQOCUMZDTGS-WRRLXBNQSA-N |
| XLogP | 1.37 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N-methylsulfanylpropane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methylsulfanylpropane-1,2-diimine?
The IUPAC name of 1-N-methylsulfanylpropane-1,2-diimine (CID 123518003) is 1-N-methylsulfanylpropane-1,2-diimine.
What is the SMILES notation for 1-N-methylsulfanylpropane-1,2-diimine?
The canonical SMILES for 1-N-methylsulfanylpropane-1,2-diimine is [H]/N=C(\C)C=NSC.
What is the InChIKey of 1-N-methylsulfanylpropane-1,2-diimine?
The InChIKey is KRLRQOCUMZDTGS-WRRLXBNQSA-N. The full InChI is InChI=1S/C4H8N2S/c1-4(5)3-6-7-2/h3,5H,1-2H3/b5-4+,6-3?.
What are the key properties of 1-N-methylsulfanylpropane-1,2-diimine?
1-N-methylsulfanylpropane-1,2-diimine has a molecular weight of 116.19 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methylsulfanylpropane-1,2-diimine is sourced from PubChem (CID 123518003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).