C27H46O7 — CID 123518120
2-[2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxyethoxy]-4-[2-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxyethoxy]-2,4-dimethylhexan-3-one (PubChem CID 123518120) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxyethoxy]-4-[2-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxyethoxy]-2,4-dimethylhexan-3-one.
| Compound Name | 2-[2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxyethoxy]-4-[2-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxyethoxy]-2,4-dimethylhexan-3-one |
|---|---|
| PubChem CID | 123518120 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | 2-[2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxyethoxy]-4-[2-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxyethoxy]-2,4-dimethylhexan-3-one |
| SMILES | C=C(C)C(=O)C(C)(C)OCCOC(C)(CC)C(=O)C(C)(C)OCCOC(C)(CC)C(=O)C(=C)C |
| InChI | InChI=1S/C27H46O7/c1-13-26(11,22(29)20(5)6)33-17-16-32-25(9,10)23(30)27(12,14-2)34-18-15-31-24(7,8)21(28)19(3)4/h3,5,13-18H2,1-2,4,6-12H3 |
| InChIKey | DCLZUCLBKIYKKO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|