C29H39NO8 — CID 123518791
(16-acetyloxy-10,11-dihydroxy-13,13-dimethyl-19-methylidene-8-oxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) piperidine-4-carboxylate (PubChem CID 123518791) has the molecular formula C29H39NO8 and a molecular weight of 529.63 g/mol. Its IUPAC name is (16-acetyloxy-10,11-dihydroxy-13,13-dimethyl-19-methylidene-8-oxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) piperidine-4-carboxylate.
| Compound Name | (16-acetyloxy-10,11-dihydroxy-13,13-dimethyl-19-methylidene-8-oxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) piperidine-4-carboxylate |
|---|---|
| PubChem CID | 123518791 |
| Molecular Formula | C29H39NO8 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | (16-acetyloxy-10,11-dihydroxy-13,13-dimethyl-19-methylidene-8-oxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) piperidine-4-carboxylate |
| SMILES | C=C1C2CCC3C45COC(O)(C(O)C4C(C)(C)CCC5OC(C)=O)C34C(=O)C1(OC(=O)C1CCNCC1)C24 |
| InChI | InChI=1S/C29H39NO8/c1-14-17-5-6-18-26-13-36-29(35,22(32)21(26)25(3,4)10-7-19(26)37-15(2)31)27(18)20(17)28(14,24(27)34)38-23(33)16-8-11-30-12-9-16/h16-22,30,32,35H,1,5-13H2,2-4H3 |
| InChIKey | CSZLRMWRTDFPLI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|