C27H29F5O4S — CID 123518796
13-methyl-11-(4-methylsulfonylphenyl)-17-(1,1,2,2,2-pentafluoroethoxy)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 123518796) has the molecular formula C27H29F5O4S and a molecular weight of 544.58 g/mol. Its IUPAC name is 13-methyl-11-(4-methylsulfonylphenyl)-17-(1,1,2,2,2-pentafluoroethoxy)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 13-methyl-11-(4-methylsulfonylphenyl)-17-(1,1,2,2,2-pentafluoroethoxy)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123518796 |
| Molecular Formula | C27H29F5O4S |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 13-methyl-11-(4-methylsulfonylphenyl)-17-(1,1,2,2,2-pentafluoroethoxy)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC(c3ccc(S(C)(=O)=O)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC2OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H29F5O4S/c1-25-14-21(15-3-7-18(8-4-15)37(2,34)35)24-19-10-6-17(33)13-16(19)5-9-20(24)22(25)11-12-23(25)36-27(31,32)26(28,29)30/h3-4,7-8,13,20-23H,5-6,9-12,14H2,1-2H3 |
| InChIKey | CNSHAWVXLPFETC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|