C31H50F3NO3S — CID 123519575
(3a-amino-1-tert-butyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) trifluoromethanesulfonate (PubChem CID 123519575) has the molecular formula C31H50F3NO3S and a molecular weight of 573.81 g/mol. Its IUPAC name is (3a-amino-1-tert-butyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) trifluoromethanesulfonate.
| Compound Name | (3a-amino-1-tert-butyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123519575 |
| Molecular Formula | C31H50F3NO3S |
| Molecular Weight | 573.81 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | (3a-amino-1-tert-butyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)C1CCC2(N)CCC3(C)C(CCC4C5(C)CC=C(OS(=O)(=O)C(F)(F)F)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C31H50F3NO3S/c1-25(2,3)19-11-16-30(35)18-17-28(7)20(24(19)30)9-10-22-27(6)14-13-23(38-39(36,37)31(32,33)34)26(4,5)21(27)12-15-29(22,28)8/h13,19-22,24H,9-12,14-18,35H2,1-8H3 |
| InChIKey | HAZGAMUWEVMPRQ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.81 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|