C17H32N3O2+ — CID 123523479
(1-amino-2-ethylidenehex-3-enylidene)-(2-hydroxy-3-piperidin-1-ylpropoxy)-methylazanium (PubChem CID 123523479) has the molecular formula C17H32N3O2+ and a molecular weight of 310.46 g/mol. Its IUPAC name is (1-amino-2-ethylidenehex-3-enylidene)-(2-hydroxy-3-piperidin-1-ylpropoxy)-methylazanium.
| Compound Name | (1-amino-2-ethylidenehex-3-enylidene)-(2-hydroxy-3-piperidin-1-ylpropoxy)-methylazanium |
|---|---|
| PubChem CID | 123523479 |
| Molecular Formula | C17H32N3O2+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (1-amino-2-ethylidenehex-3-enylidene)-(2-hydroxy-3-piperidin-1-ylpropoxy)-methylazanium |
| SMILES | CC=C(C=CCC)C(N)=[N+](C)OCC(O)CN1CCCCC1 |
| InChI | InChI=1S/C17H31N3O2/c1-4-6-10-15(5-2)17(18)19(3)22-14-16(21)13-20-11-8-7-9-12-20/h5-6,10,16,18,21H,4,7-9,11-14H2,1-3H3/p+1 |
| InChIKey | JTWCXEXCJFYXKK-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 61.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|