C16H30N4O2 — CID 144530510
(Z,2E)-2-ethylidene-N'-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-(methylamino)pent-3-enimidamide (PubChem CID 144530510) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-N'-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-(methylamino)pent-3-enimidamide.
| Compound Name | (Z,2E)-2-ethylidene-N'-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-(methylamino)pent-3-enimidamide |
|---|---|
| PubChem CID | 144530510 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (Z,2E)-2-ethylidene-N'-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-(methylamino)pent-3-enimidamide |
| SMILES | C/C=C(\C=C/CNC)C(/N)=N/OCC(O)CN1CCCCC1 |
| InChI | InChI=1S/C16H30N4O2/c1-3-14(8-7-9-18-2)16(17)19-22-13-15(21)12-20-10-5-4-6-11-20/h3,7-8,15,18,21H,4-6,9-13H2,1-2H3,(H2,17,19)/b8-7-,14-3+ |
| InChIKey | NWTXQMSMHCFLQC-ABUIMMHISA-N |
| XLogP | 0.84 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|