C15H22ClN3O3 — CID 167080244
(1Z,2E,4Z)-2-ethenyl-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-nitrosopenta-2,4-dienimidoyl chloride (PubChem CID 167080244) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is (1Z,2E,4Z)-2-ethenyl-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-nitrosopenta-2,4-dienimidoyl chloride.
| Compound Name | (1Z,2E,4Z)-2-ethenyl-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-nitrosopenta-2,4-dienimidoyl chloride |
|---|---|
| PubChem CID | 167080244 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (1Z,2E,4Z)-2-ethenyl-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-5-nitrosopenta-2,4-dienimidoyl chloride |
| SMILES | C=CC(=C\C=C/N=O)/C(Cl)=N/OCC(O)CN1CCCCC1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-2-13(7-6-8-17-21)15(16)18-22-12-14(20)11-19-9-4-3-5-10-19/h2,6-8,14,20H,1,3-5,9-12H2/b8-6-,13-7+,18-15- |
| InChIKey | JGFRJYQLIYKBIG-UZIAWHKPSA-N |
| XLogP | 2.79 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|