C11H9ClN2 — CID 123523890
(5-chloro-6-methanimidoylcyclonona-1,2,4,6,7-pentaen-1-yl)methanimine (PubChem CID 123523890) has the molecular formula C11H9ClN2 and a molecular weight of 204.66 g/mol. Its IUPAC name is (5-chloro-6-methanimidoylcyclonona-1,2,4,6,7-pentaen-1-yl)methanimine.
| Compound Name | (5-chloro-6-methanimidoylcyclonona-1,2,4,6,7-pentaen-1-yl)methanimine |
|---|---|
| PubChem CID | 123523890 |
| Molecular Formula | C11H9ClN2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (5-chloro-6-methanimidoylcyclonona-1,2,4,6,7-pentaen-1-yl)methanimine |
| SMILES | [H]/N=C/C1=C=CC=C(Cl)C(/C=N/[H])=C=CC1 |
| InChI | InChI=1S/C11H9ClN2/c12-11-6-2-4-9(7-13)3-1-5-10(11)8-14/h1-2,6-8,13-14H,3H2/b11-6?,13-7+,14-8+ |
| InChIKey | NPKUQMWTWIHZED-HIXRQRMCSA-N |
| XLogP | 2.97 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|