C8H10ClN — CID 163518027
(4-chloro-6-methylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 163518027) has the molecular formula C8H10ClN and a molecular weight of 155.63 g/mol. Its IUPAC name is (4-chloro-6-methylcyclohexa-1,5-dien-1-yl)methanimine.
| Compound Name | (4-chloro-6-methylcyclohexa-1,5-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 163518027 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | (4-chloro-6-methylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | [H]/N=C/C1=CCC(Cl)C=C1C |
| InChI | InChI=1S/C8H10ClN/c1-6-4-8(9)3-2-7(6)5-10/h2,4-5,8,10H,3H2,1H3/b10-5+ |
| InChIKey | DIKWDDZXGUBPIZ-BJMVGYQFSA-N |
| XLogP | 2.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|