C9H11ClN2 — CID 90992265
1-(2-chloro-6-methylcyclohexa-1,5-dien-1-yl)-N-(methylideneamino)methanimine (PubChem CID 90992265) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 1-(2-chloro-6-methylcyclohexa-1,5-dien-1-yl)-N-(methylideneamino)methanimine.
| Compound Name | 1-(2-chloro-6-methylcyclohexa-1,5-dien-1-yl)-N-(methylideneamino)methanimine |
|---|---|
| PubChem CID | 90992265 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1-(2-chloro-6-methylcyclohexa-1,5-dien-1-yl)-N-(methylideneamino)methanimine |
| SMILES | C=NN=CC1=C(Cl)CCC=C1C |
| InChI | InChI=1S/C9H11ClN2/c1-7-4-3-5-9(10)8(7)6-12-11-2/h4,6H,2-3,5H2,1H3 |
| InChIKey | TZJWZNBVVZWJQL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|