C10H10N2 — CID 143195380
7-methyl-8H-cyclohepta[d]pyridazine (PubChem CID 143195380) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 7-methyl-8H-cyclohepta[d]pyridazine.
| Compound Name | 7-methyl-8H-cyclohepta[d]pyridazine |
|---|---|
| PubChem CID | 143195380 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 7-methyl-8H-cyclohepta[d]pyridazine |
| SMILES | CC1=CC=c2cnncc2=CC1 |
| InChI | InChI=1S/C10H10N2/c1-8-2-4-9-6-11-12-7-10(9)5-3-8/h2,4-7H,3H2,1H3 |
| InChIKey | GBVACTMNOAVAPM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |