C12H16ClN — CID 178047791
(2E,5Z)-7-(chloromethyl)-3-ethyl-4-methylideneocta-2,5,7-trien-1-imine (PubChem CID 178047791) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (2E,5Z)-7-(chloromethyl)-3-ethyl-4-methylideneocta-2,5,7-trien-1-imine.
| Compound Name | (2E,5Z)-7-(chloromethyl)-3-ethyl-4-methylideneocta-2,5,7-trien-1-imine |
|---|---|
| PubChem CID | 178047791 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (2E,5Z)-7-(chloromethyl)-3-ethyl-4-methylideneocta-2,5,7-trien-1-imine |
| SMILES | [H]/N=C/C=C(\CC)C(=C)/C=C\C(=C)CCl |
| InChI | InChI=1S/C12H16ClN/c1-4-12(7-8-14)11(3)6-5-10(2)9-13/h5-8,14H,2-4,9H2,1H3/b6-5-,12-7+,14-8+ |
| InChIKey | TUEIGJIXCBDIDI-ROTPRYAASA-N |
| XLogP | 3.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|