C9H15N — CID 123756427
4-ethylidenehept-2-en-1-imine (PubChem CID 123756427) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 4-ethylidenehept-2-en-1-imine.
| Compound Name | 4-ethylidenehept-2-en-1-imine |
|---|---|
| PubChem CID | 123756427 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 4-ethylidenehept-2-en-1-imine |
| SMILES | [H]/N=C/C=CC(=CC)CCC |
| InChI | InChI=1S/C9H15N/c1-3-6-9(4-2)7-5-8-10/h4-5,7-8,10H,3,6H2,1-2H3/b7-5?,9-4?,10-8+ |
| InChIKey | XVDPLIPGUMFZNC-LRPZUMBMSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|