C22H25BrN4O2 — CID 123525200
6-(bromomethyl)-N-cyclopentyl-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-indazole-4-carboxamide (PubChem CID 123525200) has the molecular formula C22H25BrN4O2 and a molecular weight of 457.37 g/mol. Its IUPAC name is 6-(bromomethyl)-N-cyclopentyl-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-indazole-4-carboxamide.
| Compound Name | 6-(bromomethyl)-N-cyclopentyl-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-indazole-4-carboxamide |
|---|---|
| PubChem CID | 123525200 |
| Molecular Formula | C22H25BrN4O2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 6-(bromomethyl)-N-cyclopentyl-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1H-indazole-4-carboxamide |
| SMILES | Cc1cc(C)c(CN(C(=O)c2cc(CBr)cc3[nH]ncc23)C2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C22H25BrN4O2/c1-13-7-14(2)25-21(28)19(13)12-27(16-5-3-4-6-16)22(29)17-8-15(10-23)9-20-18(17)11-24-26-20/h7-9,11,16H,3-6,10,12H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | IBVFZAWPNBUEJB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|