C28H36N6O2 — CID 123974095
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N-(2-methylprop-2-enyl)-6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-1H-pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 123974095) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N-(2-methylprop-2-enyl)-6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-1H-pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N-(2-methylprop-2-enyl)-6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-1H-pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 123974095 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-N-(2-methylprop-2-enyl)-6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-1H-pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | C=C(C)CN(Cc1c(C)cc(C)[nH]c1=O)C(=O)c1cc(C2=CC(C)(C)NC(C)(C)C2)nc2[nH]ncc12 |
| InChI | InChI=1S/C28H36N6O2/c1-16(2)14-34(15-22-17(3)9-18(4)30-25(22)35)26(36)20-10-23(31-24-21(20)13-29-32-24)19-11-27(5,6)33-28(7,8)12-19/h9-11,13,33H,1,12,14-15H2,2-8H3,(H,30,35)(H,29,31,32) |
| InChIKey | CNDAEDVKSLERDY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|