C18H22N4 — CID 123526560
2,8-dimethyl-1-(1-methylpiperidin-3-yl)imidazo[4,5-c]quinoline (PubChem CID 123526560) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2,8-dimethyl-1-(1-methylpiperidin-3-yl)imidazo[4,5-c]quinoline.
| Compound Name | 2,8-dimethyl-1-(1-methylpiperidin-3-yl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 123526560 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2,8-dimethyl-1-(1-methylpiperidin-3-yl)imidazo[4,5-c]quinoline |
| SMILES | Cc1ccc2ncc3nc(C)n(C4CCCN(C)C4)c3c2c1 |
| InChI | InChI=1S/C18H22N4/c1-12-6-7-16-15(9-12)18-17(10-19-16)20-13(2)22(18)14-5-4-8-21(3)11-14/h6-7,9-10,14H,4-5,8,11H2,1-3H3 |
| InChIKey | KWGZHFOENORECO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |