C21H21N7O — CID 162479694
8-isocyano-2-[(4-methoxypyrazol-1-yl)methyl]-1-[(3R)-1-methylpyrrolidin-3-yl]imidazo[4,5-c]quinoline (PubChem CID 162479694) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 8-isocyano-2-[(4-methoxypyrazol-1-yl)methyl]-1-[(3R)-1-methylpyrrolidin-3-yl]imidazo[4,5-c]quinoline.
| Compound Name | 8-isocyano-2-[(4-methoxypyrazol-1-yl)methyl]-1-[(3R)-1-methylpyrrolidin-3-yl]imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 162479694 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 8-isocyano-2-[(4-methoxypyrazol-1-yl)methyl]-1-[(3R)-1-methylpyrrolidin-3-yl]imidazo[4,5-c]quinoline |
| SMILES | [C-]#[N+]c1ccc2ncc3nc(Cn4cc(OC)cn4)n([C@@H]4CCN(C)C4)c3c2c1 |
| InChI | InChI=1S/C21H21N7O/c1-22-14-4-5-18-17(8-14)21-19(10-23-18)25-20(13-27-12-16(29-3)9-24-27)28(21)15-6-7-26(2)11-15/h4-5,8-10,12,15H,6-7,11,13H2,2-3H3/t15-/m1/s1 |
| InChIKey | DZLIALZNJZYZJL-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 65.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|