C23H24N6O3 — CID 158120988
formic acid;8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]-2-[(3-methylpyrazol-1-yl)methyl]imidazo[4,5-c]quinoline (PubChem CID 158120988) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is formic acid;8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]-2-[(3-methylpyrazol-1-yl)methyl]imidazo[4,5-c]quinoline.
| Compound Name | formic acid;8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]-2-[(3-methylpyrazol-1-yl)methyl]imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 158120988 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | formic acid;8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]-2-[(3-methylpyrazol-1-yl)methyl]imidazo[4,5-c]quinoline |
| SMILES | O=CO.[C-]#[N+]c1ccc2ncc3nc(Cn4ccc(C)n4)n([C@@H]4CCO[C@H](C)C4)c3c2c1 |
| InChI | InChI=1S/C22H22N6O.CH2O2/c1-14-6-8-27(26-14)13-21-25-20-12-24-19-5-4-16(23-3)11-18(19)22(20)28(21)17-7-9-29-15(2)10-17;2-1-3/h4-6,8,11-12,15,17H,7,9-10,13H2,1-2H3;1H,(H,2,3)/t15-,17-;/m1./s1 |
| InChIKey | FRPIHROXCGPNNO-SSPJITILSA-N |
| XLogP | 4.13 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|