C25H25N5O4 — CID 158622591
2-cyclopropyl-4-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-1,3-oxazole;formic acid (PubChem CID 158622591) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-cyclopropyl-4-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-1,3-oxazole;formic acid.
| Compound Name | 2-cyclopropyl-4-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-1,3-oxazole;formic acid |
|---|---|
| PubChem CID | 158622591 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-cyclopropyl-4-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-1,3-oxazole;formic acid |
| SMILES | O=CO.[C-]#[N+]c1ccc2ncc3nc(Cc4coc(C5CC5)n4)n([C@@H]4CCO[C@H](C)C4)c3c2c1 |
| InChI | InChI=1S/C24H23N5O2.CH2O2/c1-14-9-18(7-8-30-14)29-22(11-17-13-31-24(27-17)15-3-4-15)28-21-12-26-20-6-5-16(25-2)10-19(20)23(21)29;2-1-3/h5-6,10,12-15,18H,3-4,7-9,11H2,1H3;1H,(H,2,3)/t14-,18-;/m1./s1 |
| InChIKey | HYENOFPNTACLNG-KEZWHQCISA-N |
| XLogP | 5.03 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|