C23H21N7OS — CID 140778428
6-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-2-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 140778428) has the molecular formula C23H21N7OS and a molecular weight of 443.54 g/mol. Its IUPAC name is 6-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-2-methylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-2-methylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 140778428 |
| Molecular Formula | C23H21N7OS |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-[[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]methyl]-2-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | [C-]#[N+]c1ccc2ncc3nc(Cc4cn5nc(C)sc5n4)n([C@@H]4CCO[C@H](C)C4)c3c2c1 |
| InChI | InChI=1S/C23H21N7OS/c1-13-8-17(6-7-31-13)30-21(10-16-12-29-23(26-16)32-14(2)28-29)27-20-11-25-19-5-4-15(24-3)9-18(19)22(20)30/h4-5,9,11-13,17H,6-8,10H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | WJSTXZQKYJKFON-CXAGYDPISA-N |
| XLogP | 4.88 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|