C9H11F2NO4S — CID 123526846
1-[3-(difluoromethoxy)-5-methylsulfonyl-2-pyridinyl]ethanol (PubChem CID 123526846) has the molecular formula C9H11F2NO4S and a molecular weight of 267.25 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-5-methylsulfonyl-2-pyridinyl]ethanol.
| Compound Name | 1-[3-(difluoromethoxy)-5-methylsulfonyl-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 123526846 |
| Molecular Formula | C9H11F2NO4S |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-[3-(difluoromethoxy)-5-methylsulfonyl-2-pyridinyl]ethanol |
| SMILES | CC(O)c1ncc(S(C)(=O)=O)cc1OC(F)F |
| InChI | InChI=1S/C9H11F2NO4S/c1-5(13)8-7(16-9(10)11)3-6(4-12-8)17(2,14)15/h3-5,9,13H,1-2H3 |
| InChIKey | UABQAINJTOZGSG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |