C14H19ClN2O2S — CID 123527073
1-(2-chlorophenyl)ethyl N-(2-amino-4-sulfanylidenepentan-3-yl)carbamate (PubChem CID 123527073) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-(2-amino-4-sulfanylidenepentan-3-yl)carbamate.
| Compound Name | 1-(2-chlorophenyl)ethyl N-(2-amino-4-sulfanylidenepentan-3-yl)carbamate |
|---|---|
| PubChem CID | 123527073 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-(2-amino-4-sulfanylidenepentan-3-yl)carbamate |
| SMILES | CC(=S)C(NC(=O)OC(C)c1ccccc1Cl)C(C)N |
| InChI | InChI=1S/C14H19ClN2O2S/c1-8(16)13(10(3)20)17-14(18)19-9(2)11-6-4-5-7-12(11)15/h4-9,13H,16H2,1-3H3,(H,17,18) |
| InChIKey | QBMHUKSIGONUIE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|