C16H22ClNO2 — CID 144534242
[(1R)-1-(2-chlorophenyl)ethyl] N-(3-methylbuta-1,3-dien-2-yl)carbamate;ethane (PubChem CID 144534242) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-(3-methylbuta-1,3-dien-2-yl)carbamate;ethane.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-(3-methylbuta-1,3-dien-2-yl)carbamate;ethane |
|---|---|
| PubChem CID | 144534242 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-(3-methylbuta-1,3-dien-2-yl)carbamate;ethane |
| SMILES | C=C(C)C(=C)NC(=O)O[C@H](C)c1ccccc1Cl.CC |
| InChI | InChI=1S/C14H16ClNO2.C2H6/c1-9(2)10(3)16-14(17)18-11(4)12-7-5-6-8-13(12)15;1-2/h5-8,11H,1,3H2,2,4H3,(H,16,17);1-2H3/t11-;/m1./s1 |
| InChIKey | APTHXQGGDZJXHZ-RFVHGSKJSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|