C20H20BrClN2O3 — CID 89411992
[(1R)-1-(2-chlorophenyl)ethyl] N-[(E)-1-(4-bromophenyl)-3-imino-1-methoxybut-1-en-2-yl]carbamate (PubChem CID 89411992) has the molecular formula C20H20BrClN2O3 and a molecular weight of 451.75 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[(E)-1-(4-bromophenyl)-3-imino-1-methoxybut-1-en-2-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[(E)-1-(4-bromophenyl)-3-imino-1-methoxybut-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 89411992 |
| Molecular Formula | C20H20BrClN2O3 |
| Molecular Weight | 451.75 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[(E)-1-(4-bromophenyl)-3-imino-1-methoxybut-1-en-2-yl]carbamate |
| SMILES | [H]/N=C(C)/C(NC(=O)O[C@H](C)c1ccccc1Cl)=C(\OC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrClN2O3/c1-12(23)18(19(26-3)14-8-10-15(21)11-9-14)24-20(25)27-13(2)16-6-4-5-7-17(16)22/h4-11,13,23H,1-3H3,(H,24,25)/b19-18+,23-12+/t13-/m1/s1 |
| InChIKey | NVYHUXCHETVAFU-HENAJYKKSA-N |
| XLogP | 5.94 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.75 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|