C15H11ClN4O — CID 123527555
4-chloro-13-phenyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one (PubChem CID 123527555) has the molecular formula C15H11ClN4O and a molecular weight of 298.73 g/mol. Its IUPAC name is 4-chloro-13-phenyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one.
| Compound Name | 4-chloro-13-phenyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 123527555 |
| Molecular Formula | C15H11ClN4O |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-chloro-13-phenyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-10-one |
| SMILES | O=C1NCC(c2ccccc2)n2c1cc1cnc(Cl)nc12 |
| InChI | InChI=1S/C15H11ClN4O/c16-15-18-7-10-6-11-14(21)17-8-12(20(11)13(10)19-15)9-4-2-1-3-5-9/h1-7,12H,8H2,(H,17,21) |
| InChIKey | OKWIROKWYTYUMJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |