C16H17ClN4O2 — CID 175961142
2-chloro-6-(diethoxymethyl)-7-pyridin-2-ylpyrrolo[2,3-d]pyrimidine (PubChem CID 175961142) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-chloro-6-(diethoxymethyl)-7-pyridin-2-ylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 2-chloro-6-(diethoxymethyl)-7-pyridin-2-ylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 175961142 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-chloro-6-(diethoxymethyl)-7-pyridin-2-ylpyrrolo[2,3-d]pyrimidine |
| SMILES | CCOC(OCC)c1cc2cnc(Cl)nc2n1-c1ccccn1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-3-22-15(23-4-2)12-9-11-10-19-16(17)20-14(11)21(12)13-7-5-6-8-18-13/h5-10,15H,3-4H2,1-2H3 |
| InChIKey | GCTDSOZBYVZMGH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|