C14H13N7O2S — CID 123527976
N'-amino-N-imino-2-pyrazolo[1,5-a]pyridin-3-yl-6-sulfamoylbenzenecarboximidamide (PubChem CID 123527976) has the molecular formula C14H13N7O2S and a molecular weight of 343.37 g/mol. Its IUPAC name is N'-amino-N-imino-2-pyrazolo[1,5-a]pyridin-3-yl-6-sulfamoylbenzenecarboximidamide.
| Compound Name | N'-amino-N-imino-2-pyrazolo[1,5-a]pyridin-3-yl-6-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 123527976 |
| Molecular Formula | C14H13N7O2S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N'-amino-N-imino-2-pyrazolo[1,5-a]pyridin-3-yl-6-sulfamoylbenzenecarboximidamide |
| SMILES | [H]/N=N/C(=NN)c1c(-c2cnn3ccccc23)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H13N7O2S/c15-19-14(20-16)13-9(4-3-6-12(13)24(17,22)23)10-8-18-21-7-2-1-5-11(10)21/h1-8,15H,16H2,(H2,17,22,23)/b19-15+,20-14? |
| InChIKey | PQVZNKDEEUDYLW-ZTEGKKOXSA-N |
| XLogP | 1.30 |
| TPSA | 152.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|